C25H36N4O2 — CID 110129969
N-[3-[(2S,4R)-4-(diethylamino)oxan-2-yl]phenyl]-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole-3-carboxamide (PubChem CID 110129969) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[3-[(2S,4R)-4-(diethylamino)oxan-2-yl]phenyl]-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole-3-carboxamide.
| Compound Name | N-[3-[(2S,4R)-4-(diethylamino)oxan-2-yl]phenyl]-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110129969 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | N-[3-[(2S,4R)-4-(diethylamino)oxan-2-yl]phenyl]-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole-3-carboxamide |
| SMILES | CCN(CC)[C@@H]1CCO[C@H](c2cccc(NC(=O)c3n[nH]c4c3CCCCCC4)c2)C1 |
| InChI | InChI=1S/C25H36N4O2/c1-3-29(4-2)20-14-15-31-23(17-20)18-10-9-11-19(16-18)26-25(30)24-21-12-7-5-6-8-13-22(21)27-28-24/h9-11,16,20,23H,3-8,12-15,17H2,1-2H3,(H,26,30)(H,27,28)/t20-,23+/m1/s1 |
| InChIKey | ALJMJJJWRTUXFH-OFNKIYASSA-N |
| XLogP | 4.88 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |