About N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide
N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide (PubChem CID 110130047) has the molecular formula C19H22N4O3
and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide |
| PubChem CID | 110130047 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide |
| SMILES | CC(=O)N[C@@H]1CCO[C@H](c2ccc(NC(=O)c3cnc(C)cn3)cc2)C1 |
| InChI | InChI=1S/C19H22N4O3/c1-12-10-21-17(11-20-12)19(25)23-15-5-3-14(4-6-15)18-9-16(7-8-26-18)22-13(2)24/h3-6,10-11,16,18H,7-9H2,1-2H3,(H,22,24)(H,23,25)/t16-,18+/m1/s1 |
| InChIKey | QXJINBWGQYDNRY-AEFFLSMTSA-N |
| XLogP | 2.39 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide?
The IUPAC name of N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide (CID 110130047) is N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide.
What is the SMILES notation for N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide?
The canonical SMILES for N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide is CC(=O)N[C@@H]1CCO[C@H](c2ccc(NC(=O)c3cnc(C)cn3)cc2)C1.
What is the InChIKey of N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide?
The InChIKey is QXJINBWGQYDNRY-AEFFLSMTSA-N. The full InChI is InChI=1S/C19H22N4O3/c1-12-10-21-17(11-20-12)19(25)23-15-5-3-14(4-6-15)18-9-16(7-8-26-18)22-13(2)24/h3-6,10-11,16,18H,7-9H2,1-2H3,(H,22,24)(H,23,25)/t16-,18+/m1/s1.
What are the key properties of N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide?
N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide has a molecular weight of 354.41 g/mol, XLogP of 2.39, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-5-methylpyrazine-2-carboxamide is sourced from PubChem (CID 110130047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).