C25H27N3O3S — CID 110130514
N,N-dimethyl-3-[4-(5,6,7,8-tetrahydronaphthalene-2-carbonyl)morpholin-2-yl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 110130514) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-(5,6,7,8-tetrahydronaphthalene-2-carbonyl)morpholin-2-yl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N,N-dimethyl-3-[4-(5,6,7,8-tetrahydronaphthalene-2-carbonyl)morpholin-2-yl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110130514 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N,N-dimethyl-3-[4-(5,6,7,8-tetrahydronaphthalene-2-carbonyl)morpholin-2-yl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1sc2ncccc2c1C1CN(C(=O)c2ccc3c(c2)CCCC3)CCO1 |
| InChI | InChI=1S/C25H27N3O3S/c1-27(2)25(30)22-21(19-8-5-11-26-23(19)32-22)20-15-28(12-13-31-20)24(29)18-10-9-16-6-3-4-7-17(16)14-18/h5,8-11,14,20H,3-4,6-7,12-13,15H2,1-2H3 |
| InChIKey | CQGWUGYIEGWYMR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |