C21H21NO3 — CID 11013093
1-[5-benzoyl-3-(4-propan-2-ylphenyl)-4H-1,2-oxazol-5-yl]ethanone (PubChem CID 11013093) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[5-benzoyl-3-(4-propan-2-ylphenyl)-4H-1,2-oxazol-5-yl]ethanone.
| Compound Name | 1-[5-benzoyl-3-(4-propan-2-ylphenyl)-4H-1,2-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 11013093 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[5-benzoyl-3-(4-propan-2-ylphenyl)-4H-1,2-oxazol-5-yl]ethanone |
| SMILES | CC(=O)C1(C(=O)c2ccccc2)CC(c2ccc(C(C)C)cc2)=NO1 |
| InChI | InChI=1S/C21H21NO3/c1-14(2)16-9-11-17(12-10-16)19-13-21(15(3)23,25-22-19)20(24)18-7-5-4-6-8-18/h4-12,14H,13H2,1-3H3 |
| InChIKey | OUGYSUNCVGWPDR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|