C20H26F2N2O2 — CID 110131018
(4R,5S)-4-(3,5-difluorophenyl)-2-(oxan-4-yl)-2,6-diazaspiro[4.6]undecan-7-one (PubChem CID 110131018) has the molecular formula C20H26F2N2O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is (4R,5S)-4-(3,5-difluorophenyl)-2-(oxan-4-yl)-2,6-diazaspiro[4.6]undecan-7-one.
| Compound Name | (4R,5S)-4-(3,5-difluorophenyl)-2-(oxan-4-yl)-2,6-diazaspiro[4.6]undecan-7-one |
|---|---|
| PubChem CID | 110131018 |
| Molecular Formula | C20H26F2N2O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (4R,5S)-4-(3,5-difluorophenyl)-2-(oxan-4-yl)-2,6-diazaspiro[4.6]undecan-7-one |
| SMILES | O=C1CCCC[C@]2(CN(C3CCOCC3)C[C@H]2c2cc(F)cc(F)c2)N1 |
| InChI | InChI=1S/C20H26F2N2O2/c21-15-9-14(10-16(22)11-15)18-12-24(17-4-7-26-8-5-17)13-20(18)6-2-1-3-19(25)23-20/h9-11,17-18H,1-8,12-13H2,(H,23,25)/t18-,20+/m0/s1 |
| InChIKey | AKMSOUODKXXSHL-AZUAARDMSA-N |
| XLogP | 2.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |