C8H5F9O4 — CID 11013103
3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-(2,2,2-trifluoroethyl) propanedioate (PubChem CID 11013103) has the molecular formula C8H5F9O4 and a molecular weight of 336.11 g/mol. Its IUPAC name is 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-(2,2,2-trifluoroethyl) propanedioate.
| Compound Name | 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-(2,2,2-trifluoroethyl) propanedioate |
|---|---|
| PubChem CID | 11013103 |
| Molecular Formula | C8H5F9O4 |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-(2,2,2-trifluoroethyl) propanedioate |
| SMILES | O=C(CC(=O)OC(C(F)(F)F)C(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C8H5F9O4/c9-6(10,11)2-20-3(18)1-4(19)21-5(7(12,13)14)8(15,16)17/h5H,1-2H2 |
| InChIKey | KLJACMDJUKTGLN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|