About N-(4-bromophenyl)-1,1-diphenylmethanimine
N-(4-bromophenyl)-1,1-diphenylmethanimine (PubChem CID 11013110) has the molecular formula C19H14BrN
and a molecular weight of 336.23 g/mol. Its IUPAC name is N-(4-bromophenyl)-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-1,1-diphenylmethanimine |
| PubChem CID | 11013110 |
| Molecular Formula | C19H14BrN |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-(4-bromophenyl)-1,1-diphenylmethanimine |
| SMILES | Brc1ccc(N=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H14BrN/c20-17-11-13-18(14-12-17)21-19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14H |
| InChIKey | QJXSMIWPAKJPCU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromophenyl)-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-1,1-diphenylmethanimine?
The IUPAC name of N-(4-bromophenyl)-1,1-diphenylmethanimine (CID 11013110) is N-(4-bromophenyl)-1,1-diphenylmethanimine.
What is the SMILES notation for N-(4-bromophenyl)-1,1-diphenylmethanimine?
The canonical SMILES for N-(4-bromophenyl)-1,1-diphenylmethanimine is Brc1ccc(N=C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-(4-bromophenyl)-1,1-diphenylmethanimine?
The InChIKey is QJXSMIWPAKJPCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14BrN/c20-17-11-13-18(14-12-17)21-19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14H.
What are the key properties of N-(4-bromophenyl)-1,1-diphenylmethanimine?
N-(4-bromophenyl)-1,1-diphenylmethanimine has a molecular weight of 336.23 g/mol, XLogP of 5.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-1,1-diphenylmethanimine is sourced from PubChem (CID 11013110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).