C19H30O5 — CID 11013186
(1R,3R,6S,10R)-3-(2-methoxyethoxymethoxymethyl)-7,7-dimethyl-11-oxatricyclo[8.2.1.01,6]tridec-4-en-12-one (PubChem CID 11013186) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (1R,3R,6S,10R)-3-(2-methoxyethoxymethoxymethyl)-7,7-dimethyl-11-oxatricyclo[8.2.1.01,6]tridec-4-en-12-one.
| Compound Name | (1R,3R,6S,10R)-3-(2-methoxyethoxymethoxymethyl)-7,7-dimethyl-11-oxatricyclo[8.2.1.01,6]tridec-4-en-12-one |
|---|---|
| PubChem CID | 11013186 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (1R,3R,6S,10R)-3-(2-methoxyethoxymethoxymethyl)-7,7-dimethyl-11-oxatricyclo[8.2.1.01,6]tridec-4-en-12-one |
| SMILES | COCCOCOC[C@H]1C=C[C@H]2C(C)(C)CC[C@@H]3C[C@@]2(C1)C(=O)O3 |
| InChI | InChI=1S/C19H30O5/c1-18(2)7-6-15-11-19(17(20)24-15)10-14(4-5-16(18)19)12-23-13-22-9-8-21-3/h4-5,14-16H,6-13H2,1-3H3/t14-,15+,16-,19+/m0/s1 |
| InChIKey | GCLUEWOSDISQRV-CYJAXWMASA-N |
| XLogP | 2.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|