C13H15N5O2 — CID 110132433
[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]-pyridazin-4-ylmethanone (PubChem CID 110132433) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is [3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]-pyridazin-4-ylmethanone.
| Compound Name | [3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 110132433 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | [3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]-pyridazin-4-ylmethanone |
| SMILES | Cc1cn[nH]c1C1COCCN1C(=O)c1ccnnc1 |
| InChI | InChI=1S/C13H15N5O2/c1-9-6-16-17-12(9)11-8-20-5-4-18(11)13(19)10-2-3-14-15-7-10/h2-3,6-7,11H,4-5,8H2,1H3,(H,16,17) |
| InChIKey | AHZXKKIKUWWHNN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |