C15H23N5O3S — CID 110132594
4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-(4-methylsulfonyl-1H-pyrazol-5-yl)morpholine (PubChem CID 110132594) has the molecular formula C15H23N5O3S and a molecular weight of 353.45 g/mol. Its IUPAC name is 4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-(4-methylsulfonyl-1H-pyrazol-5-yl)morpholine.
| Compound Name | 4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-(4-methylsulfonyl-1H-pyrazol-5-yl)morpholine |
|---|---|
| PubChem CID | 110132594 |
| Molecular Formula | C15H23N5O3S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-(4-methylsulfonyl-1H-pyrazol-5-yl)morpholine |
| SMILES | CCn1cc(CN2CCOCC2c2[nH]ncc2S(C)(=O)=O)c(C)n1 |
| InChI | InChI=1S/C15H23N5O3S/c1-4-20-9-12(11(2)18-20)8-19-5-6-23-10-13(19)15-14(7-16-17-15)24(3,21)22/h7,9,13H,4-6,8,10H2,1-3H3,(H,16,17) |
| InChIKey | YVASVLODRGGMSK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |