About 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one
5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 110132644) has the molecular formula C15H17N5OS
and a molecular weight of 315.40 g/mol. Its IUPAC name is 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 110132644 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(C2CCN(Cc3nccs3)CC2)nc2cc[nH]n12 |
| InChI | InChI=1S/C15H17N5OS/c21-15-9-12(18-13-1-4-17-20(13)15)11-2-6-19(7-3-11)10-14-16-5-8-22-14/h1,4-5,8-9,11,17H,2-3,6-7,10H2 |
| InChIKey | UFQZKLFSJKTAQZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 110132644) is 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is O=c1cc(C2CCN(Cc3nccs3)CC2)nc2cc[nH]n12.
What is the InChIKey of 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is UFQZKLFSJKTAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5OS/c21-15-9-12(18-13-1-4-17-20(13)15)11-2-6-19(7-3-11)10-14-16-5-8-22-14/h1,4-5,8-9,11,17H,2-3,6-7,10H2.
What are the key properties of 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 315.40 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 110132644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).