C17H28O7 — CID 11013346
methyl 3-[(3aS,5R,6S,6aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,6-trimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]propanoate (PubChem CID 11013346) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is methyl 3-[(3aS,5R,6S,6aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,6-trimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]propanoate.
| Compound Name | methyl 3-[(3aS,5R,6S,6aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,6-trimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]propanoate |
|---|---|
| PubChem CID | 11013346 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl 3-[(3aS,5R,6S,6aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,6-trimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]propanoate |
| SMILES | COC(=O)CC[C@@]12O[C@@H]([C@H]3COC(C)(C)O3)[C@H](C)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C17H28O7/c1-10-13(11-9-20-15(2,3)21-11)22-17(8-7-12(18)19-6)14(10)23-16(4,5)24-17/h10-11,13-14H,7-9H2,1-6H3/t10-,11+,13+,14-,17-/m0/s1 |
| InChIKey | CEKKGHGYCYUPNF-UKYKABIHSA-N |
| XLogP | 1.97 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |