C20H25FN4O — CID 110133543
[(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 110133543) has the molecular formula C20H25FN4O and a molecular weight of 356.44 g/mol. Its IUPAC name is [(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 110133543 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | CN1CCC[C@@H]2N(C(=O)c3cc(-c4ccc(F)cc4)n[nH]3)CCC[C@@]21C |
| InChI | InChI=1S/C20H25FN4O/c1-20-10-4-12-25(18(20)5-3-11-24(20)2)19(26)17-13-16(22-23-17)14-6-8-15(21)9-7-14/h6-9,13,18H,3-5,10-12H2,1-2H3,(H,22,23)/t18-,20-/m0/s1 |
| InChIKey | OQDVQRCALHSFIS-ICSRJNTNSA-N |
| XLogP | 3.30 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |