C18H28N4O2 — CID 110133563
1-[(4aS,8aR)-4a-methyl-5-(2-propan-2-ylpyrazole-3-carbonyl)-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone (PubChem CID 110133563) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[(4aS,8aR)-4a-methyl-5-(2-propan-2-ylpyrazole-3-carbonyl)-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone.
| Compound Name | 1-[(4aS,8aR)-4a-methyl-5-(2-propan-2-ylpyrazole-3-carbonyl)-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 110133563 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[(4aS,8aR)-4a-methyl-5-(2-propan-2-ylpyrazole-3-carbonyl)-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@]2(C)[C@H]1CCCN2C(=O)c1ccnn1C(C)C |
| InChI | InChI=1S/C18H28N4O2/c1-13(2)22-15(8-10-19-22)17(24)21-12-5-7-16-18(21,4)9-6-11-20(16)14(3)23/h8,10,13,16H,5-7,9,11-12H2,1-4H3/t16-,18+/m1/s1 |
| InChIKey | AYQXPOUXBYNGFW-AEFFLSMTSA-N |
| XLogP | 2.47 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |