C22H32O3 — CID 11013364
[(2Z,4E,8E)-3,7-dimethyl-6-oxo-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienyl] acetate (PubChem CID 11013364) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(2Z,4E,8E)-3,7-dimethyl-6-oxo-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienyl] acetate.
| Compound Name | [(2Z,4E,8E)-3,7-dimethyl-6-oxo-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienyl] acetate |
|---|---|
| PubChem CID | 11013364 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(2Z,4E,8E)-3,7-dimethyl-6-oxo-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(C)\C=C\C(=O)C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C22H32O3/c1-16(13-15-25-19(4)23)9-12-21(24)18(3)10-11-20-17(2)8-7-14-22(20,5)6/h9-13,18H,7-8,14-15H2,1-6H3/b11-10+,12-9+,16-13- |
| InChIKey | NKQJFISQTMGHCK-MADVWYTMSA-N |
| XLogP | 5.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|