C23H33NO4 — CID 110134036
N-[(2R,4R,4aS,8aR)-2-(2,2-dimethyl-3H-1-benzofuran-5-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide (PubChem CID 110134036) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-[(2R,4R,4aS,8aR)-2-(2,2-dimethyl-3H-1-benzofuran-5-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide.
| Compound Name | N-[(2R,4R,4aS,8aR)-2-(2,2-dimethyl-3H-1-benzofuran-5-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 110134036 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | N-[(2R,4R,4aS,8aR)-2-(2,2-dimethyl-3H-1-benzofuran-5-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)N[C@@H]1C[C@H](c2ccc3c(c2)CC(C)(C)O3)O[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C23H33NO4/c1-23(2)14-16-12-15(8-9-19(16)28-23)21-13-18(24-22(25)10-11-26-3)17-6-4-5-7-20(17)27-21/h8-9,12,17-18,20-21H,4-7,10-11,13-14H2,1-3H3,(H,24,25)/t17-,18+,20+,21+/m0/s1 |
| InChIKey | UGXUMZSBJLYQHT-UYWIDEMCSA-N |
| XLogP | 3.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |