C22H31NO3 — CID 110134153
N-[(5S,6S,8R,10S)-5-(4-hydroxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide (PubChem CID 110134153) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is N-[(5S,6S,8R,10S)-5-(4-hydroxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide.
| Compound Name | N-[(5S,6S,8R,10S)-5-(4-hydroxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide |
|---|---|
| PubChem CID | 110134153 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N-[(5S,6S,8R,10S)-5-(4-hydroxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide |
| SMILES | CCCC(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](c4ccc(O)cc4)OCCC31C2 |
| InChI | InChI=1S/C22H31NO3/c1-4-5-18(25)23-20-21(2,3)15-12-17-19(14-6-8-16(24)9-7-14)26-11-10-22(17,20)13-15/h6-9,15,17,19-20,24H,4-5,10-13H2,1-3H3,(H,23,25)/t15-,17-,19-,20+,22?/m1/s1 |
| InChIKey | QMGJKBQSQJVFDN-PWGYFPBISA-N |
| XLogP | 4.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |