C25H32N2O2 — CID 110134285
N-[(5S,6S,8R,10S)-9,9-dimethyl-5-quinolin-5-yl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide (PubChem CID 110134285) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-[(5S,6S,8R,10S)-9,9-dimethyl-5-quinolin-5-yl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide.
| Compound Name | N-[(5S,6S,8R,10S)-9,9-dimethyl-5-quinolin-5-yl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide |
|---|---|
| PubChem CID | 110134285 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-[(5S,6S,8R,10S)-9,9-dimethyl-5-quinolin-5-yl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide |
| SMILES | CCCC(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](c4cccc5ncccc45)OCCC31C2 |
| InChI | InChI=1S/C25H32N2O2/c1-4-7-21(28)27-23-24(2,3)16-14-19-22(29-13-11-25(19,23)15-16)18-8-5-10-20-17(18)9-6-12-26-20/h5-6,8-10,12,16,19,22-23H,4,7,11,13-15H2,1-3H3,(H,27,28)/t16-,19-,22-,23+,25?/m1/s1 |
| InChIKey | NUSRLWSYYRAVFZ-YOQHNWCNSA-N |
| XLogP | 5.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |