C25H31NO4 — CID 110134348
3-hydroxy-N-[(5S,6S,8R,10S)-5-(2-hydroxynaphthalen-1-yl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide (PubChem CID 110134348) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-hydroxy-N-[(5S,6S,8R,10S)-5-(2-hydroxynaphthalen-1-yl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide.
| Compound Name | 3-hydroxy-N-[(5S,6S,8R,10S)-5-(2-hydroxynaphthalen-1-yl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
|---|---|
| PubChem CID | 110134348 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 3-hydroxy-N-[(5S,6S,8R,10S)-5-(2-hydroxynaphthalen-1-yl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
| SMILES | CC1(C)[C@@H]2C[C@@H]3[C@@H](c4c(O)ccc5ccccc45)OCCC3(C2)[C@H]1NC(=O)CCO |
| InChI | InChI=1S/C25H31NO4/c1-24(2)16-13-18-22(21-17-6-4-3-5-15(17)7-8-19(21)28)30-12-10-25(18,14-16)23(24)26-20(29)9-11-27/h3-8,16,18,22-23,27-28H,9-14H2,1-2H3,(H,26,29)/t16-,18-,22+,23+,25?/m1/s1 |
| InChIKey | XKAYKGOYAZFSEN-TXJXIFOESA-N |
| XLogP | 3.93 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |