C23H33NO3 — CID 110134381
N-[(5S,6S,8R,10S)-5-(4-hydroxy-3,5-dimethylphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide (PubChem CID 110134381) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is N-[(5S,6S,8R,10S)-5-(4-hydroxy-3,5-dimethylphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide.
| Compound Name | N-[(5S,6S,8R,10S)-5-(4-hydroxy-3,5-dimethylphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
|---|---|
| PubChem CID | 110134381 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | N-[(5S,6S,8R,10S)-5-(4-hydroxy-3,5-dimethylphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
| SMILES | CCC(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](c4cc(C)c(O)c(C)c4)OCCC31C2 |
| InChI | InChI=1S/C23H33NO3/c1-6-18(25)24-21-22(4,5)16-11-17-20(27-8-7-23(17,21)12-16)15-9-13(2)19(26)14(3)10-15/h9-10,16-17,20-21,26H,6-8,11-12H2,1-5H3,(H,24,25)/t16-,17-,20-,21+,23?/m1/s1 |
| InChIKey | HEBRIWYUPPGSAH-WIKRAHGDSA-N |
| XLogP | 4.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |