C25H33N3O2 — CID 110134431
N-[(5S,6S,8R,10S)-9,9-dimethyl-5-(4-pyrazol-1-ylphenyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide (PubChem CID 110134431) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[(5S,6S,8R,10S)-9,9-dimethyl-5-(4-pyrazol-1-ylphenyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide.
| Compound Name | N-[(5S,6S,8R,10S)-9,9-dimethyl-5-(4-pyrazol-1-ylphenyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide |
|---|---|
| PubChem CID | 110134431 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[(5S,6S,8R,10S)-9,9-dimethyl-5-(4-pyrazol-1-ylphenyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]butanamide |
| SMILES | CCCC(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](c4ccc(-n5cccn5)cc4)OCCC31C2 |
| InChI | InChI=1S/C25H33N3O2/c1-4-6-21(29)27-23-24(2,3)18-15-20-22(30-14-11-25(20,23)16-18)17-7-9-19(10-8-17)28-13-5-12-26-28/h5,7-10,12-13,18,20,22-23H,4,6,11,14-16H2,1-3H3,(H,27,29)/t18-,20-,22-,23+,25?/m1/s1 |
| InChIKey | HKQSEHKKBCAIIM-CYOWMFKSSA-N |
| XLogP | 4.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |