C23H33NO3 — CID 110134820
(5S,6S,8R,10R)-9,9-dimethyl-5-[3-(morpholin-4-ylmethyl)phenyl]-4-oxatricyclo[6.2.1.01,6]undecan-10-ol (PubChem CID 110134820) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is (5S,6S,8R,10R)-9,9-dimethyl-5-[3-(morpholin-4-ylmethyl)phenyl]-4-oxatricyclo[6.2.1.01,6]undecan-10-ol.
| Compound Name | (5S,6S,8R,10R)-9,9-dimethyl-5-[3-(morpholin-4-ylmethyl)phenyl]-4-oxatricyclo[6.2.1.01,6]undecan-10-ol |
|---|---|
| PubChem CID | 110134820 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (5S,6S,8R,10R)-9,9-dimethyl-5-[3-(morpholin-4-ylmethyl)phenyl]-4-oxatricyclo[6.2.1.01,6]undecan-10-ol |
| SMILES | CC1(C)[C@@H]2C[C@@H]3[C@@H](c4cccc(CN5CCOCC5)c4)OCCC3(C2)[C@@H]1O |
| InChI | InChI=1S/C23H33NO3/c1-22(2)18-13-19-20(27-9-6-23(19,14-18)21(22)25)17-5-3-4-16(12-17)15-24-7-10-26-11-8-24/h3-5,12,18-21,25H,6-11,13-15H2,1-2H3/t18-,19-,20-,21-,23?/m1/s1 |
| InChIKey | LRHXODIKVZDUKO-OPMOUVDSSA-N |
| XLogP | 3.39 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |