C22H31NO3 — CID 110135023
N-[(5S,6S,8R,10R)-5-(4-hydroxy-3,5-dimethylphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide (PubChem CID 110135023) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is N-[(5S,6S,8R,10R)-5-(4-hydroxy-3,5-dimethylphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide.
| Compound Name | N-[(5S,6S,8R,10R)-5-(4-hydroxy-3,5-dimethylphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
|---|---|
| PubChem CID | 110135023 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N-[(5S,6S,8R,10R)-5-(4-hydroxy-3,5-dimethylphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](c4cc(C)c(O)c(C)c4)OCCC31C2 |
| InChI | InChI=1S/C22H31NO3/c1-12-8-15(9-13(2)18(12)25)19-17-10-16-11-22(17,6-7-26-19)20(21(16,4)5)23-14(3)24/h8-9,16-17,19-20,25H,6-7,10-11H2,1-5H3,(H,23,24)/t16-,17-,19-,20-,22?/m1/s1 |
| InChIKey | CXNXUKZLKULADI-KPAMAVSKSA-N |
| XLogP | 4.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |