C13H13F3O4 — CID 110135092
(3aS,4R,9aR)-4-methoxy-6-(trifluoromethoxy)-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromene (PubChem CID 110135092) has the molecular formula C13H13F3O4 and a molecular weight of 290.24 g/mol. Its IUPAC name is (3aS,4R,9aR)-4-methoxy-6-(trifluoromethoxy)-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromene.
| Compound Name | (3aS,4R,9aR)-4-methoxy-6-(trifluoromethoxy)-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromene |
|---|---|
| PubChem CID | 110135092 |
| Molecular Formula | C13H13F3O4 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (3aS,4R,9aR)-4-methoxy-6-(trifluoromethoxy)-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromene |
| SMILES | CO[C@H]1c2cc(OC(F)(F)F)ccc2O[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C13H13F3O4/c1-17-11-8-4-5-18-12(8)19-10-3-2-7(6-9(10)11)20-13(14,15)16/h2-3,6,8,11-12H,4-5H2,1H3/t8-,11+,12+/m0/s1 |
| InChIKey | CALAAVKLKGTYFX-XXILOJSOSA-N |
| XLogP | 3.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |