About 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole
3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole (PubChem CID 110135210) has the molecular formula C15H19N3O
and a molecular weight of 257.34 g/mol. Its IUPAC name is 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole |
| PubChem CID | 110135210 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1ccnc(C2CCNCC2)c1 |
| InChI | InChI=1S/C15H19N3O/c1-10-15(11(2)19-18-10)13-5-8-17-14(9-13)12-3-6-16-7-4-12/h5,8-9,12,16H,3-4,6-7H2,1-2H3 |
| InChIKey | VYMJMXJRBXDRLP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole?
The IUPAC name of 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole (CID 110135210) is 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole.
What is the SMILES notation for 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole?
The canonical SMILES for 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole is Cc1noc(C)c1-c1ccnc(C2CCNCC2)c1.
What is the InChIKey of 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole?
The InChIKey is VYMJMXJRBXDRLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O/c1-10-15(11(2)19-18-10)13-5-8-17-14(9-13)12-3-6-16-7-4-12/h5,8-9,12,16H,3-4,6-7H2,1-2H3.
What are the key properties of 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole?
3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole has a molecular weight of 257.34 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-(2-piperidin-4-yl-4-pyridinyl)-1,2-oxazole is sourced from PubChem (CID 110135210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).