C20H32N4O7 — CID 110135219
tert-butyl N-[5-[[(1R,2R,3R,4R)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclohexyl]amino]-5-oxopentyl]carbamate (PubChem CID 110135219) has the molecular formula C20H32N4O7 and a molecular weight of 440.50 g/mol. Its IUPAC name is tert-butyl N-[5-[[(1R,2R,3R,4R)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclohexyl]amino]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[(1R,2R,3R,4R)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclohexyl]amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 110135219 |
| Molecular Formula | C20H32N4O7 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | tert-butyl N-[5-[[(1R,2R,3R,4R)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclohexyl]amino]-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)N[C@@H]1CC[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H32N4O7/c1-20(2,3)31-19(30)21-10-5-4-6-14(25)22-12-7-8-13(17(28)16(12)27)24-11-9-15(26)23-18(24)29/h9,11-13,16-17,27-28H,4-8,10H2,1-3H3,(H,21,30)(H,22,25)(H,23,26,29)/t12-,13-,16-,17-/m1/s1 |
| InChIKey | ZBVQEYXZBIWSPU-BQGCOEIASA-N |
| XLogP | -0.23 |
| TPSA | 162.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|