C20H33NO4 — CID 11013578
methyl (Z)-6-[(9R,9aR)-3-methoxy-5-oxo-9-propan-2-yl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-9a-yl]hex-4-enoate (PubChem CID 11013578) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is methyl (Z)-6-[(9R,9aR)-3-methoxy-5-oxo-9-propan-2-yl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-9a-yl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(9R,9aR)-3-methoxy-5-oxo-9-propan-2-yl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-9a-yl]hex-4-enoate |
|---|---|
| PubChem CID | 11013578 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | methyl (Z)-6-[(9R,9aR)-3-methoxy-5-oxo-9-propan-2-yl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-9a-yl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@@]12CCC(OC)N1C(=O)CCC[C@@H]2C(C)C |
| InChI | InChI=1S/C20H33NO4/c1-15(2)16-9-8-10-17(22)21-18(24-3)12-14-20(16,21)13-7-5-6-11-19(23)25-4/h5,7,15-16,18H,6,8-14H2,1-4H3/b7-5-/t16-,18?,20+/m1/s1 |
| InChIKey | JYBKWGBUMFBHNB-IIHOPAQWSA-N |
| XLogP | 3.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|