C20H20N2O2S — CID 11013605
(3aR,6aS)-1-benzyl-3-[(1R)-1-phenylethyl]-4,6a-dihydro-3aH-thieno[3,4-d]imidazole-2,6-dione (PubChem CID 11013605) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (3aR,6aS)-1-benzyl-3-[(1R)-1-phenylethyl]-4,6a-dihydro-3aH-thieno[3,4-d]imidazole-2,6-dione.
| Compound Name | (3aR,6aS)-1-benzyl-3-[(1R)-1-phenylethyl]-4,6a-dihydro-3aH-thieno[3,4-d]imidazole-2,6-dione |
|---|---|
| PubChem CID | 11013605 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (3aR,6aS)-1-benzyl-3-[(1R)-1-phenylethyl]-4,6a-dihydro-3aH-thieno[3,4-d]imidazole-2,6-dione |
| SMILES | C[C@H](c1ccccc1)N1C(=O)N(Cc2ccccc2)[C@@H]2C(=O)SC[C@@H]21 |
| InChI | InChI=1S/C20H20N2O2S/c1-14(16-10-6-3-7-11-16)22-17-13-25-19(23)18(17)21(20(22)24)12-15-8-4-2-5-9-15/h2-11,14,17-18H,12-13H2,1H3/t14-,17+,18+/m1/s1 |
| InChIKey | NURXGLFUPWTIHX-JLSDUUJJSA-N |
| XLogP | 3.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|