C15H28O5S2 — CID 11013609
(1S,2R,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(1,3-dithian-2-yl)-1,3-dimethoxybutan-2-ol (PubChem CID 11013609) has the molecular formula C15H28O5S2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (1S,2R,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(1,3-dithian-2-yl)-1,3-dimethoxybutan-2-ol.
| Compound Name | (1S,2R,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(1,3-dithian-2-yl)-1,3-dimethoxybutan-2-ol |
|---|---|
| PubChem CID | 11013609 |
| Molecular Formula | C15H28O5S2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (1S,2R,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(1,3-dithian-2-yl)-1,3-dimethoxybutan-2-ol |
| SMILES | CO[C@@H]([C@H](O)[C@@H](CC1SCCCS1)OC)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H28O5S2/c1-15(2)19-9-11(20-15)14(18-4)13(16)10(17-3)8-12-21-6-5-7-22-12/h10-14,16H,5-9H2,1-4H3/t10-,11+,13-,14-/m1/s1 |
| InChIKey | XBPLZQBFZLELSO-ZMJPVWNMSA-N |
| XLogP | 2.12 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |