C19H19N3O4 — CID 11013629
[(2S,4E)-4-[[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-5-oxooxolan-2-yl]methyl benzoate (PubChem CID 11013629) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is [(2S,4E)-4-[[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-5-oxooxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,4E)-4-[[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-5-oxooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11013629 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [(2S,4E)-4-[[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-5-oxooxolan-2-yl]methyl benzoate |
| SMILES | Cc1cc(C)nc(N/C=C2\C[C@@H](COC(=O)c3ccccc3)OC2=O)n1 |
| InChI | InChI=1S/C19H19N3O4/c1-12-8-13(2)22-19(21-12)20-10-15-9-16(26-18(15)24)11-25-17(23)14-6-4-3-5-7-14/h3-8,10,16H,9,11H2,1-2H3,(H,20,21,22)/b15-10+/t16-/m0/s1 |
| InChIKey | LLXYLWBBXZHDEI-KMPOOHAWSA-N |
| XLogP | 2.56 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|