C22H28N4O3 — CID 110136461
(2R,3aS,9aR)-2-[(4-methoxyphenyl)methyl]-1-(2-methylpyrazole-3-carbonyl)-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one (PubChem CID 110136461) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2R,3aS,9aR)-2-[(4-methoxyphenyl)methyl]-1-(2-methylpyrazole-3-carbonyl)-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one.
| Compound Name | (2R,3aS,9aR)-2-[(4-methoxyphenyl)methyl]-1-(2-methylpyrazole-3-carbonyl)-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 110136461 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (2R,3aS,9aR)-2-[(4-methoxyphenyl)methyl]-1-(2-methylpyrazole-3-carbonyl)-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one |
| SMILES | COc1ccc(C[C@@H]2C[C@@H]3NC(=O)CCCC[C@H]3N2C(=O)c2ccnn2C)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-25-20(11-12-23-25)22(28)26-16(13-15-7-9-17(29-2)10-8-15)14-18-19(26)5-3-4-6-21(27)24-18/h7-12,16,18-19H,3-6,13-14H2,1-2H3,(H,24,27)/t16-,18+,19-/m1/s1 |
| InChIKey | HNXOYCZTEVOTEO-NZSAHSFTSA-N |
| XLogP | 2.31 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |