C25H31FN2O3 — CID 110136462
(2R,3aS,9aR)-1-[(2,3-dimethoxyphenyl)methyl]-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one (PubChem CID 110136462) has the molecular formula C25H31FN2O3 and a molecular weight of 426.53 g/mol. Its IUPAC name is (2R,3aS,9aR)-1-[(2,3-dimethoxyphenyl)methyl]-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one.
| Compound Name | (2R,3aS,9aR)-1-[(2,3-dimethoxyphenyl)methyl]-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 110136462 |
| Molecular Formula | C25H31FN2O3 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (2R,3aS,9aR)-1-[(2,3-dimethoxyphenyl)methyl]-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one |
| SMILES | COc1cccc(CN2[C@H](Cc3cccc(F)c3)C[C@@H]3NC(=O)CCCC[C@H]32)c1OC |
| InChI | InChI=1S/C25H31FN2O3/c1-30-23-11-6-8-18(25(23)31-2)16-28-20(14-17-7-5-9-19(26)13-17)15-21-22(28)10-3-4-12-24(29)27-21/h5-9,11,13,20-22H,3-4,10,12,14-16H2,1-2H3,(H,27,29)/t20-,21+,22-/m1/s1 |
| InChIKey | KKXYNGQWZHHNFA-BHIFYINESA-N |
| XLogP | 4.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |