C23H33N3O3 — CID 110137117
N-[(3aS,7aR)-5-acetyl-2-[(3-cyclopentyloxyphenyl)methyl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3a-yl]acetamide (PubChem CID 110137117) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[(3aS,7aR)-5-acetyl-2-[(3-cyclopentyloxyphenyl)methyl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3a-yl]acetamide.
| Compound Name | N-[(3aS,7aR)-5-acetyl-2-[(3-cyclopentyloxyphenyl)methyl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3a-yl]acetamide |
|---|---|
| PubChem CID | 110137117 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | N-[(3aS,7aR)-5-acetyl-2-[(3-cyclopentyloxyphenyl)methyl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3a-yl]acetamide |
| SMILES | CC(=O)N[C@]12CN(Cc3cccc(OC4CCCC4)c3)C[C@H]1CCN(C(C)=O)C2 |
| InChI | InChI=1S/C23H33N3O3/c1-17(27)24-23-15-25(14-20(23)10-11-26(16-23)18(2)28)13-19-6-5-9-22(12-19)29-21-7-3-4-8-21/h5-6,9,12,20-21H,3-4,7-8,10-11,13-16H2,1-2H3,(H,24,27)/t20-,23+/m1/s1 |
| InChIKey | OBGZWXVJGVJSGD-OFNKIYASSA-N |
| XLogP | 2.57 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |