C21H32FN3O3S — CID 110137169
(3aR,9aR)-N,N-diethyl-4-[(4-fluorophenyl)methyl]-3a-methyl-5-oxo-3,6,7,8,9,9a-hexahydro-2H-pyrrolo[3,2-b]azocine-1-sulfonamide (PubChem CID 110137169) has the molecular formula C21H32FN3O3S and a molecular weight of 425.57 g/mol. Its IUPAC name is (3aR,9aR)-N,N-diethyl-4-[(4-fluorophenyl)methyl]-3a-methyl-5-oxo-3,6,7,8,9,9a-hexahydro-2H-pyrrolo[3,2-b]azocine-1-sulfonamide.
| Compound Name | (3aR,9aR)-N,N-diethyl-4-[(4-fluorophenyl)methyl]-3a-methyl-5-oxo-3,6,7,8,9,9a-hexahydro-2H-pyrrolo[3,2-b]azocine-1-sulfonamide |
|---|---|
| PubChem CID | 110137169 |
| Molecular Formula | C21H32FN3O3S |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (3aR,9aR)-N,N-diethyl-4-[(4-fluorophenyl)methyl]-3a-methyl-5-oxo-3,6,7,8,9,9a-hexahydro-2H-pyrrolo[3,2-b]azocine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CC[C@]2(C)[C@H]1CCCCC(=O)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H32FN3O3S/c1-4-23(5-2)29(27,28)25-15-14-21(3)19(25)8-6-7-9-20(26)24(21)16-17-10-12-18(22)13-11-17/h10-13,19H,4-9,14-16H2,1-3H3/t19-,21-/m1/s1 |
| InChIKey | UKSBVGTWLQWFJW-TZIWHRDSSA-N |
| XLogP | 3.15 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |