C19H16O3S2 — CID 11013727
3,3-bis(4-methylphenyl)-3a,6a-dihydrodithiolo[3,4-c]furan-4,6-dione (PubChem CID 11013727) has the molecular formula C19H16O3S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3,3-bis(4-methylphenyl)-3a,6a-dihydrodithiolo[3,4-c]furan-4,6-dione.
| Compound Name | 3,3-bis(4-methylphenyl)-3a,6a-dihydrodithiolo[3,4-c]furan-4,6-dione |
|---|---|
| PubChem CID | 11013727 |
| Molecular Formula | C19H16O3S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 3,3-bis(4-methylphenyl)-3a,6a-dihydrodithiolo[3,4-c]furan-4,6-dione |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)SSC3C(=O)OC(=O)C32)cc1 |
| InChI | InChI=1S/C19H16O3S2/c1-11-3-7-13(8-4-11)19(14-9-5-12(2)6-10-14)15-16(23-24-19)18(21)22-17(15)20/h3-10,15-16H,1-2H3 |
| InChIKey | VQBMQDNAWRIZEJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|