C27H34N4O2 — CID 110137306
(3aS,9aR)-1-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl]-4-[(3-methylphenyl)methyl]-2,3,3a,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one (PubChem CID 110137306) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is (3aS,9aR)-1-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl]-4-[(3-methylphenyl)methyl]-2,3,3a,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one.
| Compound Name | (3aS,9aR)-1-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl]-4-[(3-methylphenyl)methyl]-2,3,3a,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 110137306 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (3aS,9aR)-1-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl]-4-[(3-methylphenyl)methyl]-2,3,3a,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
| SMILES | Cc1cccc(CN2C(=O)CCCC[C@@H]3[C@@H]2CCN3Cc2ccc3c(c2)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C27H34N4O2/c1-19-7-6-8-20(15-19)18-31-24-13-14-30(23(24)9-4-5-10-26(31)32)17-21-11-12-22-25(16-21)29(3)27(33)28(22)2/h6-8,11-12,15-16,23-24H,4-5,9-10,13-14,17-18H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | PZWSFZYKZZTSLG-RPWUZVMVSA-N |
| XLogP | 3.73 |
| TPSA | 50.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |