C19H28N2O2 — CID 110137340
1-[(2S,3aS,9aS)-3a-methyl-2-phenyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-2-methoxyethanone (PubChem CID 110137340) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-[(2S,3aS,9aS)-3a-methyl-2-phenyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[(2S,3aS,9aS)-3a-methyl-2-phenyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 110137340 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-[(2S,3aS,9aS)-3a-methyl-2-phenyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1[C@H]2CCCCCN[C@@]2(C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H28N2O2/c1-19-13-16(15-9-5-3-6-10-15)21(18(22)14-23-2)17(19)11-7-4-8-12-20-19/h3,5-6,9-10,16-17,20H,4,7-8,11-14H2,1-2H3/t16-,17-,19-/m0/s1 |
| InChIKey | HUSIMLITDLWYOV-LNLFQRSKSA-N |
| XLogP | 2.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |