C21H28O5 — CID 11013838
ethyl 2-[(1R,2S,3R,7R,10S,12S,16R)-2,4-dimethyl-6,9-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadec-4-en-3-yl]acetate (PubChem CID 11013838) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,3R,7R,10S,12S,16R)-2,4-dimethyl-6,9-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadec-4-en-3-yl]acetate.
| Compound Name | ethyl 2-[(1R,2S,3R,7R,10S,12S,16R)-2,4-dimethyl-6,9-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadec-4-en-3-yl]acetate |
|---|---|
| PubChem CID | 11013838 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | ethyl 2-[(1R,2S,3R,7R,10S,12S,16R)-2,4-dimethyl-6,9-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadec-4-en-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C(C)=CC(=O)[C@@H]2CC(=O)[C@H]3C[C@@H]4OCC[C@@H]4[C@H]3[C@@]12C |
| InChI | InChI=1S/C21H28O5/c1-4-25-19(24)10-14-11(2)7-17(23)15-9-16(22)13-8-18-12(5-6-26-18)20(13)21(14,15)3/h7,12-15,18,20H,4-6,8-10H2,1-3H3/t12-,13+,14+,15-,18-,20+,21-/m0/s1 |
| InChIKey | LGRXDIYHNAPHFM-AMOUDFBRSA-N |
| XLogP | 2.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |