C17H21N5 — CID 110138533
(3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-2-pyrimidin-5-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 110138533) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-2-pyrimidin-5-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-2-pyrimidin-5-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 110138533 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-2-pyrimidin-5-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | c1cnc(C[C@H]2CCC[C@@H]3CN(c4cncnc4)C[C@H]23)cn1 |
| InChI | InChI=1S/C17H21N5/c1-2-13(6-15-7-18-4-5-21-15)17-11-22(10-14(17)3-1)16-8-19-12-20-9-16/h4-5,7-9,12-14,17H,1-3,6,10-11H2/t13-,14-,17-/m1/s1 |
| InChIKey | HHYMNUYQIWGRLN-CKEIUWERSA-N |
| XLogP | 2.36 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |