About 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one
3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 110138708) has the molecular formula C20H23N3O2S
and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one |
| PubChem CID | 110138708 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | CN1C(=O)C2(CCN(C(=O)c3cncs3)CC2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C20H23N3O2S/c1-22-16(11-15-5-3-2-4-6-15)12-20(19(22)25)7-9-23(10-8-20)18(24)17-13-21-14-26-17/h2-6,13-14,16H,7-12H2,1H3 |
| InChIKey | SQXXQRLMVMKFKT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one?
The IUPAC name of 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one (CID 110138708) is 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one.
What is the SMILES notation for 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one?
The canonical SMILES for 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one is CN1C(=O)C2(CCN(C(=O)c3cncs3)CC2)CC1Cc1ccccc1.
What is the InChIKey of 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one?
The InChIKey is SQXXQRLMVMKFKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O2S/c1-22-16(11-15-5-3-2-4-6-15)12-20(19(22)25)7-9-23(10-8-20)18(24)17-13-21-14-26-17/h2-6,13-14,16H,7-12H2,1H3.
What are the key properties of 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one?
3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one has a molecular weight of 369.49 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-methyl-8-(1,3-thiazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one is sourced from PubChem (CID 110138708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).