C14H21N3O2 — CID 110138821
[(4aS,8aS)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydro-2H-1,5-naphthyridin-1-yl]-(1,3-oxazol-5-yl)methanone (PubChem CID 110138821) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is [(4aS,8aS)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydro-2H-1,5-naphthyridin-1-yl]-(1,3-oxazol-5-yl)methanone.
| Compound Name | [(4aS,8aS)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydro-2H-1,5-naphthyridin-1-yl]-(1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 110138821 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | [(4aS,8aS)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydro-2H-1,5-naphthyridin-1-yl]-(1,3-oxazol-5-yl)methanone |
| SMILES | CN1CCC[C@@]2(C)[C@@H]1CCCN2C(=O)c1cnco1 |
| InChI | InChI=1S/C14H21N3O2/c1-14-6-4-7-16(2)12(14)5-3-8-17(14)13(18)11-9-15-10-19-11/h9-10,12H,3-8H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | LZEBZQQWJWOOGY-JSGCOSHPSA-N |
| XLogP | 1.76 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |