C20H23FN4O — CID 110139114
1-[(3aR,4R,6aS)-4-[methyl(pyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 110139114) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-4-[methyl(pyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-[(3aR,4R,6aS)-4-[methyl(pyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 110139114 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[(3aR,4R,6aS)-4-[methyl(pyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | CN(c1cccnn1)[C@@H]1CC[C@@H]2CN(C(=O)Cc3ccccc3F)C[C@@H]21 |
| InChI | InChI=1S/C20H23FN4O/c1-24(19-7-4-10-22-23-19)18-9-8-15-12-25(13-16(15)18)20(26)11-14-5-2-3-6-17(14)21/h2-7,10,15-16,18H,8-9,11-13H2,1H3/t15-,16+,18-/m1/s1 |
| InChIKey | VGOVHTOHJVHQEZ-SOLBZPMBSA-N |
| XLogP | 2.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |