C21H21N5O — CID 110139120
[(3aR,4R,6aS)-4-(pyridazin-3-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-quinolin-5-ylmethanone (PubChem CID 110139120) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-(pyridazin-3-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-quinolin-5-ylmethanone.
| Compound Name | [(3aR,4R,6aS)-4-(pyridazin-3-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-quinolin-5-ylmethanone |
|---|---|
| PubChem CID | 110139120 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [(3aR,4R,6aS)-4-(pyridazin-3-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-quinolin-5-ylmethanone |
| SMILES | O=C(c1cccc2ncccc12)N1C[C@H]2CC[C@@H](Nc3cccnn3)[C@H]2C1 |
| InChI | InChI=1S/C21H21N5O/c27-21(16-4-1-6-18-15(16)5-2-10-22-18)26-12-14-8-9-19(17(14)13-26)24-20-7-3-11-23-25-20/h1-7,10-11,14,17,19H,8-9,12-13H2,(H,24,25)/t14-,17+,19-/m1/s1 |
| InChIKey | OHAHAZHXXNVFDZ-DKSSEZFCSA-N |
| XLogP | 2.99 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |