C19H24N4OS — CID 110139153
[(3aR,4R,6aS)-4-[methyl-(6-methylpyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 110139153) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-[methyl-(6-methylpyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-4-[methyl-(6-methylpyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 110139153 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [(3aR,4R,6aS)-4-[methyl-(6-methylpyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(N(C)[C@@H]2CC[C@@H]3CN(C(=O)c4ccc(C)s4)C[C@@H]32)nn1 |
| InChI | InChI=1S/C19H24N4OS/c1-12-4-9-18(21-20-12)22(3)16-7-6-14-10-23(11-15(14)16)19(24)17-8-5-13(2)25-17/h4-5,8-9,14-16H,6-7,10-11H2,1-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | BUJYNYRWADCRHJ-OWCLPIDISA-N |
| XLogP | 3.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |