About N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine
N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine (PubChem CID 110139184) has the molecular formula C15H19N5S
and a molecular weight of 301.42 g/mol. Its IUPAC name is N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine.
Molecular Properties
| Compound Name | N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine |
| PubChem CID | 110139184 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine |
| SMILES | c1cc(NC2CC3(CCN(Cc4cscn4)C3)C2)ncn1 |
| InChI | InChI=1S/C15H19N5S/c1-3-16-10-17-14(1)19-12-5-15(6-12)2-4-20(9-15)7-13-8-21-11-18-13/h1,3,8,10-12H,2,4-7,9H2,(H,16,17,19) |
| InChIKey | OQBZDIUWWRDVQT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine?
The IUPAC name of N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine (CID 110139184) is N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine.
What is the SMILES notation for N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine?
The canonical SMILES for N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine is c1cc(NC2CC3(CCN(Cc4cscn4)C3)C2)ncn1.
What is the InChIKey of N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine?
The InChIKey is OQBZDIUWWRDVQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5S/c1-3-16-10-17-14(1)19-12-5-15(6-12)2-4-20(9-15)7-13-8-21-11-18-13/h1,3,8,10-12H,2,4-7,9H2,(H,16,17,19).
What are the key properties of N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine?
N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine has a molecular weight of 301.42 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrimidin-4-yl-6-(1,3-thiazol-4-ylmethyl)-6-azaspiro[3.4]octan-2-amine is sourced from PubChem (CID 110139184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).