C17H22N4S — CID 110139315
N-methyl-N-pyrimidin-4-yl-6-(thiophen-3-ylmethyl)-6-azaspiro[3.4]octan-2-amine (PubChem CID 110139315) has the molecular formula C17H22N4S and a molecular weight of 314.46 g/mol. Its IUPAC name is N-methyl-N-pyrimidin-4-yl-6-(thiophen-3-ylmethyl)-6-azaspiro[3.4]octan-2-amine.
| Compound Name | N-methyl-N-pyrimidin-4-yl-6-(thiophen-3-ylmethyl)-6-azaspiro[3.4]octan-2-amine |
|---|---|
| PubChem CID | 110139315 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-methyl-N-pyrimidin-4-yl-6-(thiophen-3-ylmethyl)-6-azaspiro[3.4]octan-2-amine |
| SMILES | CN(c1ccncn1)C1CC2(CCN(Cc3ccsc3)C2)C1 |
| InChI | InChI=1S/C17H22N4S/c1-20(16-2-5-18-13-19-16)15-8-17(9-15)4-6-21(12-17)10-14-3-7-22-11-14/h2-3,5,7,11,13,15H,4,6,8-10,12H2,1H3 |
| InChIKey | RXNYMIJEBLDUNW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |