C20H22FNO2S — CID 110140063
(4S,4aR,5S,8aR)-1-[(4-fluorophenyl)methyl]-5-hydroxy-4-thiophen-2-yl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one (PubChem CID 110140063) has the molecular formula C20H22FNO2S and a molecular weight of 359.47 g/mol. Its IUPAC name is (4S,4aR,5S,8aR)-1-[(4-fluorophenyl)methyl]-5-hydroxy-4-thiophen-2-yl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one.
| Compound Name | (4S,4aR,5S,8aR)-1-[(4-fluorophenyl)methyl]-5-hydroxy-4-thiophen-2-yl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
|---|---|
| PubChem CID | 110140063 |
| Molecular Formula | C20H22FNO2S |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (4S,4aR,5S,8aR)-1-[(4-fluorophenyl)methyl]-5-hydroxy-4-thiophen-2-yl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
| SMILES | O=C1C[C@H](c2cccs2)[C@@H]2[C@@H](CCC[C@@H]2O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO2S/c21-14-8-6-13(7-9-14)12-22-16-3-1-4-17(23)20(16)15(11-19(22)24)18-5-2-10-25-18/h2,5-10,15-17,20,23H,1,3-4,11-12H2/t15-,16-,17+,20-/m1/s1 |
| InChIKey | GUNSVTCPIWQYIV-PDOICOKGSA-N |
| XLogP | 3.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |