C17H19N5O — CID 110140089
(3aR,4R,6aS)-1-methyl-4-pyrazin-2-yl-3-(pyridin-3-ylmethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one (PubChem CID 110140089) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is (3aR,4R,6aS)-1-methyl-4-pyrazin-2-yl-3-(pyridin-3-ylmethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one.
| Compound Name | (3aR,4R,6aS)-1-methyl-4-pyrazin-2-yl-3-(pyridin-3-ylmethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one |
|---|---|
| PubChem CID | 110140089 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (3aR,4R,6aS)-1-methyl-4-pyrazin-2-yl-3-(pyridin-3-ylmethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one |
| SMILES | CN1C(=O)N(Cc2cccnc2)[C@@H]2[C@H](c3cnccn3)CC[C@@H]21 |
| InChI | InChI=1S/C17H19N5O/c1-21-15-5-4-13(14-10-19-7-8-20-14)16(15)22(17(21)23)11-12-3-2-6-18-9-12/h2-3,6-10,13,15-16H,4-5,11H2,1H3/t13-,15-,16+/m0/s1 |
| InChIKey | GEJWABCJHUPOOD-CWRNSKLLSA-N |
| XLogP | 2.05 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |