C20H30O6 — CID 11014013
[(1S,3aS,4S,6R)-1-(hydroxymethyl)-7-[(2S,4R)-4-hydroxy-5-oxooxolan-2-yl]-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-inden-4-yl] acetate (PubChem CID 11014013) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is [(1S,3aS,4S,6R)-1-(hydroxymethyl)-7-[(2S,4R)-4-hydroxy-5-oxooxolan-2-yl]-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-inden-4-yl] acetate.
| Compound Name | [(1S,3aS,4S,6R)-1-(hydroxymethyl)-7-[(2S,4R)-4-hydroxy-5-oxooxolan-2-yl]-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-inden-4-yl] acetate |
|---|---|
| PubChem CID | 11014013 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [(1S,3aS,4S,6R)-1-(hydroxymethyl)-7-[(2S,4R)-4-hydroxy-5-oxooxolan-2-yl]-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-inden-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C)C([C@@H]2C[C@@H](O)C(=O)O2)=C2[C@@H]1C(C)(C)C[C@]2(C)CO |
| InChI | InChI=1S/C20H30O6/c1-10-6-14(25-11(2)22)16-17(20(5,9-21)8-19(16,3)4)15(10)13-7-12(23)18(24)26-13/h10,12-14,16,21,23H,6-9H2,1-5H3/t10-,12-,13+,14+,16-,20-/m1/s1 |
| InChIKey | RVXLTRZIAMMATE-JMTSMVSISA-N |
| XLogP | 1.98 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|