C24H32N4O — CID 110140875
[(1S,2S,4R,9S,10S)-2-benzyl-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-(1-methylimidazol-2-yl)methanone (PubChem CID 110140875) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is [(1S,2S,4R,9S,10S)-2-benzyl-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-(1-methylimidazol-2-yl)methanone.
| Compound Name | [(1S,2S,4R,9S,10S)-2-benzyl-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 110140875 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | [(1S,2S,4R,9S,10S)-2-benzyl-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-(1-methylimidazol-2-yl)methanone |
| SMILES | CN1[C@H]2CCCC[C@H]3N(C(=O)c4nccn4C)[C@@H](Cc4ccccc4)[C@@H]1C[C@@]23C |
| InChI | InChI=1S/C24H32N4O/c1-24-16-19-18(15-17-9-5-4-6-10-17)28(23(29)22-25-13-14-26(22)2)21(24)12-8-7-11-20(24)27(19)3/h4-6,9-10,13-14,18-21H,7-8,11-12,15-16H2,1-3H3/t18-,19-,20-,21+,24-/m0/s1 |
| InChIKey | KFELEZJWAAPFFX-ROLQDKDTSA-N |
| XLogP | 3.51 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |